a nitrogen rich explosive
Banned troll
Posts: 176
Registered: 28-3-2016
Member Is Offline
Mood: Repentant
|
|
Synthesis of 2-nitro 3-acetoxy 1-propane and precursors
How would I synthesise 2-nitro 3-acetoxy 1-propane? I need it for experiments with heptanitropentane. There is little mention of 2-N 3-A 1-P on the
Internet or in any literature that I can find.
I can't think of a better signature.
|
|
|
gsd
National Hazard
Posts: 847
Registered: 18-8-2005
Member Is Offline
Mood: No Mood
|
|
Quote: Originally posted by a nitrogen rich explosive  | | How would I synthesise 2-nitro 3-acetoxy 1-propane? I need it for experiments with heptanitropentane. There is little mention of 2-N 3-A 1-P on the
Internet or in any literature that I can find. |
2-nitro 3-acetoxy 1-propane
Something is wrong here. If it is propane, then it can't be 1-
Do you mean 1-propene?
gsd
|
|
|
a nitrogen rich explosive
Banned troll
Posts: 176
Registered: 28-3-2016
Member Is Offline
Mood: Repentant
|
|
Sorry about that, wasn't thinking...
Any idea of synthesis (the only paper I can find costs £59.99.)
I can't think of a better signature.
|
|
|
gsd
National Hazard
Posts: 847
Registered: 18-8-2005
Member Is Offline
Mood: No Mood
|
|
What is the reference?
Is this what you have in mind? http://link.springer.com/article/10.1007%2FBF00912288
And BTW are you confirming that the target compound is 2-nitro 3-acetoxy 1-propene ?
gsd
|
|
|
a nitrogen rich explosive
Banned troll
Posts: 176
Registered: 28-3-2016
Member Is Offline
Mood: Repentant
|
|
Yes that is. It isn't as expensive as I thought it was.
Yes, that is the target compound.
I will be reacting it with nitroform to form HNP, then nitrating the pyridium salt of that into octonitropentane.
My worry is that just about everything in this reaction is explosive/extremely oxidising (virtually all steps within the reaction yield alkenes in
various states of nitration.)
[Edited on 14-4-2016 by a nitrogen rich explosive]
I can't think of a better signature.
|
|
|
PHILOU Zrealone
International Hazard
Posts: 2893
Registered: 20-5-2002
Location: Brussel
Member Is Offline
Mood: Bis-diazo-dinitro-hydroquinonic
|
|
Very easy...
CH3-NO2 + 2 CH2=O --> HO-CH2-CH(-NO2)-CH2-OH
(amongst other molecules like HO-CH2-CH2-NO2, CH2=CH-NO2, polynitrovinyle, O2N-CH2-CH2-CH2-NO2, HO-CH2-C(-NO2)=CH2 and of course (HO-CH2-)3C-NO2
depending on initial reactant ratio and reaction conditions)
The reverse reaction is also possible...
(HO-CH2-)3C-NO2 -base-> HO-CH2-CH(-NO2)-CH2-OH + CH2=O (CH3OH and HCO2H in basic media) -base-> HO-CH2-CH2-NO2 + CH2=O --> CH3-NO2 + CH2=O
Then after isolation...
HO-CH2-CH(-NO2)-CH2-OH + Acetic anhydride --> CH3-CO-O-CH2-CH(-NO2)-CH2-O-CO-CH3 + CH3-CO-O-CH2-C(-NO2)=CH2 + CH3-CO2H (equal to CH3-CO-OH)
HO-CH2-C(-NO2)=CH2 + Acetic anhydride --> CH3-CO-O-CH2-CH(-NO2)-CH2-O-CO-CH3 + CH3-CO-O-CH2-C(-NO2)=CH2 + CH3-CO2H (equal to CH3-CO-OH)
PH Z (PHILOU Zrealone)
"Physic is all what never works; Chemistry is all what stinks and explodes!"-"Life that deadly disease, sexually transmitted."(W.Allen)
|
|
|
a nitrogen rich explosive
Banned troll
Posts: 176
Registered: 28-3-2016
Member Is Offline
Mood: Repentant
|
|
1) How would you separate the 3-hydroxypropyl nitrate from all the other things that form?
2) How the hell would you separate the 2-nitro 3-acetoxy 1-propene from the acetic acid and the acetic acid derivatives?
I can't think of a better signature.
|
|
|
PHILOU Zrealone
International Hazard
Posts: 2893
Registered: 20-5-2002
Location: Brussel
Member Is Offline
Mood: Bis-diazo-dinitro-hydroquinonic
|
|
| Quote: Originally posted by a nitrogen rich explosive | 1) How would you separate the 3-hydroxypropyl nitrate from all the other things that form?
2) How the hell would you separate the 2-nitro 3-acetoxy 1-propene from the acetic acid and the acetic acid derivatives? |
1) Where does your HOCH2-CH2-CH2-ONO2 come from?
Not present!
2) Acetic acid is soluble in water while product should'nt be. Acetic acid is also very volatile while product should'nt be
--> Crystalization, chromatography.
Are you sure you know enough chemistry to go in that synthesis?
PH Z (PHILOU Zrealone)
"Physic is all what never works; Chemistry is all what stinks and explodes!"-"Life that deadly disease, sexually transmitted."(W.Allen)
|
|
|
a nitrogen rich explosive
Banned troll
Posts: 176
Registered: 28-3-2016
Member Is Offline
Mood: Repentant
|
|
1) I was reading this over in a cursory manner. I just added up the molcular formula C3H7NO4 and I worked it out as 3-hydroxypropyl nitrate (3-carbon
chain, NO3 bonded at the end, 6 hydrogen atoms joined to the carbon chain, one hydroxy group bonded to the other end - 3-hydroxypropyl nitrate.) Sorry
if I got that wrong.
2) Didn't think about that... Need to apply myself more before I post.
[Edited on 15-4-2016 by a nitrogen rich explosive]
[Edited on 15-4-2016 by a nitrogen rich explosive]
I can't think of a better signature.
|
|
|
![[*]](images/xpblue/default_icon.gif){kind=icon}
