How would I synthesise 2-nitro 3-acetoxy 1-propane? I need it for experiments with heptanitropentane. There is little mention of 2-N 3-A 1-P on the
Internet or in any literature that I can find.gsd - 14-4-2016 at 02:09
How would I synthesise 2-nitro 3-acetoxy 1-propane? I need it for experiments with heptanitropentane. There is little mention of 2-N 3-A 1-P on the
Internet or in any literature that I can find.
2-nitro 3-acetoxy 1-propane
Something is wrong here. If it is propane, then it can't be 1-
Do you mean 1-propene?
gsda nitrogen rich explosive - 14-4-2016 at 03:07
Sorry about that, wasn't thinking...
Any idea of synthesis (the only paper I can find costs £59.99.)gsd - 14-4-2016 at 03:17
And BTW are you confirming that the target compound is 2-nitro 3-acetoxy 1-propene ?
gsda nitrogen rich explosive - 14-4-2016 at 04:36
Yes that is. It isn't as expensive as I thought it was.
Yes, that is the target compound.
I will be reacting it with nitroform to form HNP, then nitrating the pyridium salt of that into octonitropentane.
My worry is that just about everything in this reaction is explosive/extremely oxidising (virtually all steps within the reaction yield alkenes in
various states of nitration.)
[Edited on 14-4-2016 by a nitrogen rich explosive]PHILOU Zrealone - 14-4-2016 at 09:15
Very easy...
CH3-NO2 + 2 CH2=O --> HO-CH2-CH(-NO2)-CH2-OH
(amongst other molecules like HO-CH2-CH2-NO2, CH2=CH-NO2, polynitrovinyle, O2N-CH2-CH2-CH2-NO2, HO-CH2-C(-NO2)=CH2 and of course (HO-CH2-)3C-NO2
depending on initial reactant ratio and reaction conditions)
The reverse reaction is also possible...
(HO-CH2-)3C-NO2 -base-> HO-CH2-CH(-NO2)-CH2-OH + CH2=O (CH3OH and HCO2H in basic media) -base-> HO-CH2-CH2-NO2 + CH2=O --> CH3-NO2 + CH2=O
Then after isolation...
HO-CH2-CH(-NO2)-CH2-OH + Acetic anhydride --> CH3-CO-O-CH2-CH(-NO2)-CH2-O-CO-CH3 + CH3-CO-O-CH2-C(-NO2)=CH2 + CH3-CO2H (equal to CH3-CO-OH)
HO-CH2-C(-NO2)=CH2 + Acetic anhydride --> CH3-CO-O-CH2-CH(-NO2)-CH2-O-CO-CH3 + CH3-CO-O-CH2-C(-NO2)=CH2 + CH3-CO2H (equal to CH3-CO-OH)a nitrogen rich explosive - 14-4-2016 at 11:00
1) How would you separate the 3-hydroxypropyl nitrate from all the other things that form?
2) How the hell would you separate the 2-nitro 3-acetoxy 1-propene from the acetic acid and the acetic acid derivatives?PHILOU Zrealone - 15-4-2016 at 05:07
1) How would you separate the 3-hydroxypropyl nitrate from all the other things that form?
2) How the hell would you separate the 2-nitro 3-acetoxy 1-propene from the acetic acid and the acetic acid derivatives?
1) Where does your HOCH2-CH2-CH2-ONO2 come from?
Not present!
2) Acetic acid is soluble in water while product should'nt be. Acetic acid is also very volatile while product should'nt be
--> Crystalization, chromatography.
Are you sure you know enough chemistry to go in that synthesis?a nitrogen rich explosive - 15-4-2016 at 05:46
1) I was reading this over in a cursory manner. I just added up the molcular formula C3H7NO4 and I worked it out as 3-hydroxypropyl nitrate (3-carbon
chain, NO3 bonded at the end, 6 hydrogen atoms joined to the carbon chain, one hydroxy group bonded to the other end - 3-hydroxypropyl nitrate.) Sorry
if I got that wrong.
2) Didn't think about that... Need to apply myself more before I post.
[Edited on 15-4-2016 by a nitrogen rich explosive]
[Edited on 15-4-2016 by a nitrogen rich explosive]
