acmurray - 19-2-2019 at 15:59
Can CO form carbonic acid when it's infused with H2O
If it does not, would it peculate through a Alkali-Hydroxyl aqueous soln unmolested such as NaOH?
My first post, would appreciate a few words of wisdom, thanks in advance.
C6(NO2)5CH2CH(CH3)N(NO2)2 - 19-2-2019 at 16:21
https://www.semanticscholar.org/paper/Catalytic-Studies-of-S...
https://chemiday.com/en/reaction/3-1-0-568
It looks like it can form either sodium carbonate and hydrogen, or else sodium formate. Unlike with CO2, neither reaction is going to happen easily by
bubbling it (I assume that's what you mean with peculate) through a solution. NaOH solution probably won't work to scrub CO.
Nearly forgot! At high temperatures, it is possible to turn steam and CO into H2 and CO2, which I guess is the neutral counterpart to the carbonate
forming reaction. But the reaction can go the other way too, so you get a mix of CO and CO2. https://en.wikipedia.org/wiki/Water-gas_shift_reaction
[Edited on 20-2-2019 by C6(NO2)5CH2CH(CH3)N(NO2)2]