Difference between revisions of "Lead picrate"

From Sciencemadness Wiki
Jump to: navigation, search
(Created blank page)
 
Line 1: Line 1:
 
+
{{Chembox
 +
| Name = Basic Lead Picrate
 +
| Reference =
 +
| IUPACName = lead(2+);2,4,6-trinitrophenolate 
 +
| PIN =
 +
| SystematicName = 2,4-Dinitro-6-(oxo{[(2,4,6-trinitrophenoxy)-λ2-plumbanyl]oxy}ammonio)phenolate
 +
| OtherNames = {{Unbulleted list
 +
  | ''Lead picrate''
 +
  | ''Lead salt of trinitrophenol''
 +
  }}
 +
<!-- Images -->
 +
| ImageFile = leadpicrate.jpeg
 +
| ImageSize = 350px
 +
| ImageAlt =
 +
| ImageName = Basic Lead Picrate
 +
| ImageFile1 =
 +
| ImageSize1 =
 +
| ImageAlt1 =
 +
| ImageName1 =
 +
| ImageFile2 =
 +
| ImageSize2 =
 +
| ImageAlt2 =
 +
| ImageName2 =
 +
| ImageFile3 =
 +
| ImageSize3 =
 +
| ImageAlt3 =
 +
| ImageName3 =
 +
| ImageFileL1 =
 +
| ImageSizeL1 =
 +
| ImageAltL1 =
 +
| ImageNameL1 =
 +
| ImageFileR1 =
 +
| ImageSizeR1 =
 +
| ImageAltR1 =
 +
| ImageNameR1 =
 +
| ImageFileL2 =
 +
| ImageSizeL2 =
 +
| ImageAltL2 =
 +
| ImageNameL2 =
 +
| ImageFileR2 =
 +
| ImageSizeR2 =
 +
| ImageAltR2 =
 +
| ImageNameR2 =
 +
<!-- Sections -->
 +
| Section1 = {{Chembox Identifiers
 +
| 3DMet =
 +
| Abbreviations =
 +
| SMILES = C1=C(C=C(C(=C1[N+](=O)[O-])[O-])[N+](=O)[O-])[N+](=O)[O-].C1=C(C=C(C(=C1[N+](=O)[O-])[O-])[N+](=O)[O-])[N+](=O)[O-].[Pb+2]
 +
  }}
 +
| Section2 = {{Chembox Properties
 +
| AtmosphericOHRateConstant =
 +
| Appearance = Orange, dense powder
 +
| BoilingPt = Detonates
 +
| BoilingPtC =
 +
| BoilingPt_ref =
 +
| BoilingPt_notes =
 +
| Density =
 +
| Formula = C12H4N6O14Pb
 +
| HenryConstant =
 +
| LogP =
 +
| MolarMass = 663.4g/mol
 +
| MeltingPt = Detonates
 +
| MeltingPtC =
 +
| MeltingPt_ref =
 +
| MeltingPt_notes =
 +
| pKa =
 +
| pKb =
 +
| Solubility = barely soluble in water at 20°C
 +
| SolubleOther =
 +
| Solvent =
 +
| VaporPressure =
 +
  }}
 +
| Section3 = {{Chembox Structure
 +
| Coordination =
 +
| CrystalStruct =
 +
| MolShape =
 +
  }}
 +
| Section4 = {{Chembox Thermochemistry
 +
| DeltaGf =
 +
| DeltaHc =
 +
| DeltaHf =
 +
| Entropy =
 +
| HeatCapacity =
 +
  }}
 +
| Section5 = {{Chembox Explosive
 +
| ShockSens = moderately shock sensitive
 +
| FrictionSens = highly friction sensitive
 +
| DetonationV =
 +
| REFactor =
 +
  }}
 +
| Section6 = {{Chembox Hazards
 +
| AutoignitionPt =
 +
| ExploLimits =
 +
| ExternalMSDS =
 +
| FlashPt =
 +
| LD50 =
 +
| LC50 =
 +
| MainHazards =
 +
| NFPA-F =
 +
| NFPA-H =
 +
| NFPA-R =
 +
| NFPA-S =
 +
  }}
 +
| Section7 = {{Chembox Related
 +
| OtherAnions =
 +
| OtherCations =
 +
| OtherFunction =
 +
| OtherFunction_label =
 +
| OtherCompounds =
 +
  }}
 +
}}

Revision as of 22:03, 14 February 2019

Basic Lead Picrate
Basic Lead Picrate
Names
IUPAC name
lead(2+);2,4,6-trinitrophenolate
Systematic IUPAC name
2,4-Dinitro-6-(oxo{[(2,4,6-trinitrophenoxy)-λ2-plumbanyl]oxy}ammonio)phenolate
Identifiers
Jmol-3D images Image
Properties
C12H4N6O14Pb
Molar mass 663.4g/mol
Appearance Orange, dense powder
Melting point Detonates
Boiling point Detonates
barely soluble in water at 20°C
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa).
Infobox references