Difference between revisions of "Lead(IV) acetate"
(Created page with "{{Chembox | Name = Lead(IV) acetate | Reference = | IUPACName = | PIN = | SystematicName = | OtherNames = {{Unbulleted list | Lead tetraacetate | Plumbic acetate ... |...") |
m |
||
(8 intermediate revisions by 2 users not shown) | |||
Line 2: | Line 2: | ||
| Name = Lead(IV) acetate | | Name = Lead(IV) acetate | ||
| Reference = | | Reference = | ||
− | | IUPACName = | + | | IUPACName = Lead(IV) acetate |
| PIN = | | PIN = | ||
| SystematicName = | | SystematicName = | ||
− | | OtherNames = | + | | OtherNames = Lead tetraacetate<br>Plumbic acetate |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
<!-- Images --> | <!-- Images --> | ||
| ImageFile = | | ImageFile = | ||
Line 48: | Line 43: | ||
| 3DMet = | | 3DMet = | ||
| Abbreviations = | | Abbreviations = | ||
− | | SMILES = | + | | SMILES = CC(=O)O[Pb](OC(C)=O)(OC(C)=O)OC(C)=O |
}} | }} | ||
| Section2 = {{Chembox Properties | | Section2 = {{Chembox Properties | ||
Line 55: | Line 50: | ||
| BoilingPt = Decomposes | | BoilingPt = Decomposes | ||
| BoilingPtC = | | BoilingPtC = | ||
− | | BoilingPt_ref = [http://onlinelibrary.wiley.com/doi/10.1002/9780470132326.ch17/summary | + | | BoilingPt_ref = [http://onlinelibrary.wiley.com/doi/10.1002/9780470132326.ch17/summary] |
| BoilingPt_notes = | | BoilingPt_notes = | ||
− | | Density = 2. | + | | Density = 2.228 g/cm<sup>3</sup> (at 17 °C) |
| Formula = PbC<sub>8</sub>H<sub>12</sub>O<sub>8</sub> | | Formula = PbC<sub>8</sub>H<sub>12</sub>O<sub>8</sub> | ||
| HenryConstant = | | HenryConstant = | ||
| LogP = | | LogP = | ||
− | | MolarMass = | + | | MolarMass = 443.376 g/mol |
− | | MeltingPt = | + | | MeltingPt = 175-180 °C |
− | | MeltingPtC = | + | | MeltingPtC = |
− | | MeltingPt_ref = [http://onlinelibrary.wiley.com/doi/10.1002/9780470132326.ch17/summary | + | | MeltingPt_ref = [http://onlinelibrary.wiley.com/doi/10.1002/9780470132326.ch17/summary] |
| MeltingPt_notes = | | MeltingPt_notes = | ||
| pKa = | | pKa = | ||
| pKb = | | pKb = | ||
− | | Solubility = | + | | Solubility = Reacts with water |
− | | SolubleOther = hot glacial acetic acid, slightly soluble in benzene, chloroform | + | | SolubleOther = Reacts with [[alcohol]]s<br>Soluble in hot glacial [[acetic acid]], slightly soluble in [[benzene]], [[chloroform]] |
| Solvent = | | Solvent = | ||
| VaporPressure = | | VaporPressure = | ||
Line 86: | Line 81: | ||
}} | }} | ||
| Section5 = {{Chembox Explosive | | Section5 = {{Chembox Explosive | ||
− | | ShockSens = | + | | ShockSens = Non-explosive |
− | | FrictionSens = | + | | FrictionSens = None |
− | | DetonationV = | + | | DetonationV = Non-explosive |
− | | REFactor = | + | | REFactor = None |
}} | }} | ||
| Section6 = {{Chembox Hazards | | Section6 = {{Chembox Hazards | ||
| AutoignitionPt = | | AutoignitionPt = | ||
| ExploLimits = | | ExploLimits = | ||
− | | ExternalMSDS = | + | | ExternalMSDS = [http://www.sparchem.com/msds/546-67-8.pdf Sparchem] |
| FlashPt = | | FlashPt = | ||
| LD50 = | | LD50 = | ||
| LC50 = | | LC50 = | ||
− | | MainHazards = | + | | MainHazards = Toxic<br>corrosive |
| NFPA-F = | | NFPA-F = | ||
| NFPA-H = | | NFPA-H = | ||
Line 109: | Line 104: | ||
| OtherFunction = | | OtherFunction = | ||
| OtherFunction_label = | | OtherFunction_label = | ||
− | | OtherCompounds = | + | | OtherCompounds = [[Lead(II) acetate]] |
}} | }} | ||
}} | }} | ||
− | '''Lead(IV) acetate''' also known as '''lead tetraacetate''' or '''plumbic acetate''' is a chemical compound, a [[lead]] salt of [[acetic acid]], with the formula Pb(CH<sub>3</sub>COO)<sub>4</sub>. | + | '''Lead(IV) acetate''' also known as '''lead tetraacetate''' or '''plumbic acetate''' is a chemical compound, a [[lead]] salt of [[acetic acid]], with the formula '''Pb(CH<sub>3</sub>COO)<sub>4</sub>'''. |
==Properties== | ==Properties== | ||
Line 122: | Line 117: | ||
==Availability== | ==Availability== | ||
− | Lead tetraacetate is sold by chemical suppliers, though due to its sensitivity to water, it's difficult to purchase. It's best to make it yourself. | + | Lead tetraacetate is sold by chemical suppliers, though due to its toxicity and sensitivity to water, it's difficult to purchase. It's best to make it yourself. |
==Preparation== | ==Preparation== | ||
There are a few ways to prepare lead(IV) acetate. | There are a few ways to prepare lead(IV) acetate. | ||
− | One method involves the reaction of minium with | + | One method involves the reaction of [[Lead(II,IV) oxide|minium]] with glacial [[acetic acid]]. This reaction produces both lead acetates as well as PbO, which can be separated via recrystallization from acetic acid. [[Acetic anhydride]] can also be used for a better yield, and if small amounts are added in the former reaction it will remove any traces of water from the reaction. |
+ | |||
+ | :Pb<sub>3</sub>O<sub>4</sub> + 6 CH<sub>3</sub>COOH → Pb(CH<sub>3</sub>COO)<sub>4</sub> + Pb(CH<sub>3</sub>COO)<sub>2</sub> + PbO + 3 H<sub>2</sub>O | ||
+ | :Pb<sub>3</sub>O<sub>4</sub> + 3 (CH<sub>3</sub>CO)<sub>2</sub>O → Pb(CH<sub>3</sub>COO)<sub>4</sub> + Pb(CH<sub>3</sub>COO)<sub>2</sub> + PbO | ||
− | Another process involves the oxidation of lead(II)acetate is acetic | + | Another process involves the oxidation of lead(II)acetate is acetic acid with [[chlorine]]. Dry chlorine gas is bubbled through the solution, which is heated to 80 °C. This reaction produces [[lead(II) chloride]] as residue. |
− | :2 Pb(CH<sub>3</sub>COO)<sub>2</sub> + Cl<sub>2</sub> | + | :2 Pb(CH<sub>3</sub>COO)<sub>2</sub> + Cl<sub>2</sub> → Pb(CH<sub>3</sub>COO)<sub>4</sub> + PbCl<sub>2</sub> |
The resulting precipitate is filtered while hot and washed with hot glacial acetic acid. The filtrate is left to crystallize. Further recrystallization from glacial acetic acid is required to remove any PbCl<sub>2</sub> impurities.<ref>http://onlinelibrary.wiley.com/doi/10.1002/9780470132326.ch17/summary</ref> | The resulting precipitate is filtered while hot and washed with hot glacial acetic acid. The filtrate is left to crystallize. Further recrystallization from glacial acetic acid is required to remove any PbCl<sub>2</sub> impurities.<ref>http://onlinelibrary.wiley.com/doi/10.1002/9780470132326.ch17/summary</ref> | ||
Line 141: | Line 139: | ||
==Projects== | ==Projects== | ||
− | *THF synthesis | + | *[[Tetrahydrofuran|THF]] synthesis |
*Aziridine synthesis | *Aziridine synthesis | ||
*Hoffmann type rearrangements | *Hoffmann type rearrangements | ||
Line 151: | Line 149: | ||
===Storage=== | ===Storage=== | ||
− | As it is sensitive to moisture and alcohols, it's best to store it in a | + | As it is sensitive to moisture and alcohols, it's best to store it in a hermetically sealed container, a desiccator or a [[glovebox]] if you have one. It is sometimes stabilized with acetic acid or acetic anhydride. |
===Disposal=== | ===Disposal=== | ||
Line 168: | Line 166: | ||
[[Category:Carcinogenic]] | [[Category:Carcinogenic]] | ||
[[Category:Materials that react with water]] | [[Category:Materials that react with water]] | ||
+ | [[Category:Neurotoxins]] |
Latest revision as of 00:11, 11 December 2019
Names | |
---|---|
IUPAC name
Lead(IV) acetate
| |
Other names
Lead tetraacetate
Plumbic acetate | |
Identifiers | |
Jmol-3D images | Image |
| |
Properties | |
PbC8H12O8 | |
Molar mass | 443.376 g/mol |
Appearance | Colorless to slight pinkish crystals |
Density | 2.228 g/cm3 (at 17 °C) |
Melting point | 175-180 °C [1] |
Boiling point | Decomposes [2] |
Reacts with water | |
Solubility | Reacts with alcohols Soluble in hot glacial acetic acid, slightly soluble in benzene, chloroform |
Hazards | |
Safety data sheet | Sparchem |
Related compounds | |
Related compounds
|
Lead(II) acetate |
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa). | |
Infobox references | |
Lead(IV) acetate also known as lead tetraacetate or plumbic acetate is a chemical compound, a lead salt of acetic acid, with the formula Pb(CH3COO)4.
Contents
Properties
Chemical
Lead tetraacetate reacts with water and ethanol to form lead(II) acetate, lead(II) oxide and acetic acid.
Physical
Lead tetraacetate is a white to slight pinkish crystals, soluble in hot acetic acid, chloroform or benzene. It has a vinegar like odor. It melts at 175 °C, and will decompose if heated too high. It has a density of 2.228 g/cm[1].
Availability
Lead tetraacetate is sold by chemical suppliers, though due to its toxicity and sensitivity to water, it's difficult to purchase. It's best to make it yourself.
Preparation
There are a few ways to prepare lead(IV) acetate.
One method involves the reaction of minium with glacial acetic acid. This reaction produces both lead acetates as well as PbO, which can be separated via recrystallization from acetic acid. Acetic anhydride can also be used for a better yield, and if small amounts are added in the former reaction it will remove any traces of water from the reaction.
- Pb3O4 + 6 CH3COOH → Pb(CH3COO)4 + Pb(CH3COO)2 + PbO + 3 H2O
- Pb3O4 + 3 (CH3CO)2O → Pb(CH3COO)4 + Pb(CH3COO)2 + PbO
Another process involves the oxidation of lead(II)acetate is acetic acid with chlorine. Dry chlorine gas is bubbled through the solution, which is heated to 80 °C. This reaction produces lead(II) chloride as residue.
- 2 Pb(CH3COO)2 + Cl2 → Pb(CH3COO)4 + PbCl2
The resulting precipitate is filtered while hot and washed with hot glacial acetic acid. The filtrate is left to crystallize. Further recrystallization from glacial acetic acid is required to remove any PbCl2 impurities.[2]
A more accessible way involves electrolysis. There are several methods described in literature.
A method described in 1922 involves the electrolysis of lead(II) acetate with acetic acid.[3] One reaction involves the electrolysis of lead(IV) sulfate in acetic acid.[4]
Projects
- THF synthesis
- Aziridine synthesis
- Hoffmann type rearrangements
- Oxidation of n-alkanes to secondary acetates [5]
Handling
Safety
Lead(IV) acetate may be fatal if ingested or inhaled. Skin contact will cause burns and can also cause lead poisoning.
Storage
As it is sensitive to moisture and alcohols, it's best to store it in a hermetically sealed container, a desiccator or a glovebox if you have one. It is sometimes stabilized with acetic acid or acetic anhydride.
Disposal
Lead tetraacetate can be reduced with a sulfide to the insoluble lead sulfide and sent to the disposal facilities.
References
- ↑ http://onlinelibrary.wiley.com/doi/10.1002/9780470132326.ch17/summary
- ↑ http://onlinelibrary.wiley.com/doi/10.1002/9780470132326.ch17/summary
- ↑ http://onlinelibrary.wiley.com/doi/10.1002/bbpc.19220282116/abstract
- ↑ http://onlinelibrary.wiley.com/doi/10.1002/bbpc.19000072205/abstract
- ↑ http://www.sciencedirect.com/science/article/pii/S0040403900943041
Relevant Sciencemadness threads
- Chemical pages without CAS Registry Number
- Articles without EBI source
- Chemical pages without ChemSpiderID
- Chemical pages without DrugBank identifier
- Articles without KEGG source
- Articles without InChI source
- Articles without UNII source
- Articles containing unverified chemical infoboxes
- Chembox articles without image
- Chemical compounds
- Organic compounds
- Lead compounds
- Acetates
- Heavy metal toxicants
- Carcinogenic
- Materials that react with water
- Neurotoxins