Difference between revisions of "Xylitol"
(→Disposal) |
(→Physical: Fixed typo) |
||
(4 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | '''Xylitol''' is a sugar alcohol used as a sweetener. | + | {{Chembox |
+ | | Name = Xylitol | ||
+ | | Reference = | ||
+ | | IUPACName = (2R,4S)-Pentane-1,2,3,4,5-pentol | ||
+ | | PIN = | ||
+ | | SystematicName = | ||
+ | | OtherNames = 1,2,3,4,5-Pentahydroxypentane<br>Xylite | ||
+ | <!-- Images --> | ||
+ | | ImageFile = Xylitol box and sample.jpg | ||
+ | | ImageSize = 250 | ||
+ | | ImageAlt = | ||
+ | | ImageCaption = Store-grade xylitol | ||
+ | | ImageName = | ||
+ | | ImageFile1 = | ||
+ | | ImageSize1 = | ||
+ | | ImageAlt1 = | ||
+ | | ImageName1 = | ||
+ | | ImageFile2 = | ||
+ | | ImageSize2 = | ||
+ | | ImageAlt2 = | ||
+ | | ImageName2 = | ||
+ | | ImageFile3 = | ||
+ | | ImageSize3 = | ||
+ | | ImageAlt3 = | ||
+ | | ImageName3 = | ||
+ | | ImageFileL1 = | ||
+ | | ImageSizeL1 = | ||
+ | | ImageAltL1 = | ||
+ | | ImageNameL1 = | ||
+ | | ImageFileR1 = | ||
+ | | ImageSizeR1 = | ||
+ | | ImageAltR1 = | ||
+ | | ImageNameR1 = | ||
+ | | ImageFileL2 = | ||
+ | | ImageSizeL2 = | ||
+ | | ImageAltL2 = | ||
+ | | ImageNameL2 = | ||
+ | | ImageFileR2 = | ||
+ | | ImageSizeR2 = | ||
+ | | ImageAltR2 = | ||
+ | | ImageNameR2 = | ||
+ | <!-- Sections --> | ||
+ | | Section1 = {{Chembox Identifiers | ||
+ | | 3DMet = | ||
+ | | Abbreviations = | ||
+ | | SMILES = O[C@H](CO)[C@H](O)[C@@H](O)CO | ||
+ | }} | ||
+ | | Section2 = {{Chembox Properties | ||
+ | | AtmosphericOHRateConstant = | ||
+ | | Appearance = White crystalline solid | ||
+ | | BoilingPt = | ||
+ | | BoilingPtC = 345.39 | ||
+ | | BoilingPt_ref = | ||
+ | | BoilingPt_notes = | ||
+ | | Density = 1.52 g/cm<sup>3</sup> | ||
+ | | Formula = C<sub>5</sub>H<sub>12</sub>O<sub>5</sub> | ||
+ | | HenryConstant = | ||
+ | | LogP = | ||
+ | | MolarMass = 152.15 g/mol | ||
+ | | MeltingPt = | ||
+ | | MeltingPtC = 92-96 | ||
+ | | MeltingPt_ref = | ||
+ | | MeltingPt_notes = | ||
+ | | pKa = | ||
+ | | pKb = | ||
+ | | Solubility = 200 g/100 ml (25 °C) | ||
+ | | SolubleOther = Soluble in [[ethanol]], [[methanol]], [[pyridine]], [[tetrahydrofuran]]<br>Insoluble in [[diethyl ether]], [[benzene]], [[chloroform]] | ||
+ | | Solubility1 = 1.2 g/100ml | ||
+ | | Solvent1 = ethanol | ||
+ | | Solubility2 = 6 g/100ml | ||
+ | | Solvent2 = methanol | ||
+ | | Solvent = | ||
+ | | VaporPressure = ~0 mmHg | ||
+ | }} | ||
+ | | Section3 = {{Chembox Structure | ||
+ | | Coordination = | ||
+ | | CrystalStruct = Rhombic | ||
+ | | MolShape = | ||
+ | }} | ||
+ | | Section4 = {{Chembox Thermochemistry | ||
+ | | DeltaGf = | ||
+ | | DeltaHc = | ||
+ | | DeltaHf = 1,100.99 kJ/mol<ref>Tewari, Yadu B.; Goldberg, Robert N.; Journal of Chemical Thermodynamics; | ||
+ | vol. 28; nb. 10; (1996); p. 1127 - 1144</ref> | ||
+ | | Entropy = | ||
+ | | HeatCapacity = | ||
+ | }} | ||
+ | | Section5 = {{Chembox Explosive | ||
+ | | ShockSens = None | ||
+ | | FrictionSens = None | ||
+ | | DetonationV = None | ||
+ | | REFactor = None | ||
+ | }} | ||
+ | | Section6 = {{Chembox Hazards | ||
+ | | AutoignitionPt = | ||
+ | | ExploLimits = | ||
+ | | ExternalMSDS = [http://ehsrms.uaa.alaska.edu/CMS/Laboratory/MSDS/MSDS%20by%20Vendor/Fisher/Xylitol.pdf Fischer Scientific] | ||
+ | | FlashPt = | ||
+ | | LD50 = | ||
+ | | LC50 = | ||
+ | | MainHazards = | ||
+ | | NFPA-F = | ||
+ | | NFPA-H = | ||
+ | | NFPA-R = | ||
+ | | NFPA-S = | ||
+ | }} | ||
+ | | Section7 = {{Chembox Related | ||
+ | | OtherAnions = | ||
+ | | OtherCations = | ||
+ | | OtherFunction = | ||
+ | | OtherFunction_label = | ||
+ | | OtherCompounds = [[Arabitol]]<br>[[Ribitol]] | ||
+ | }} | ||
+ | }} | ||
+ | '''Xylitol''' is a sugar alcohol used as a sweetener. It has the chemical formula '''C<sub>5</sub>H<sub>12</sub>O<sub>5</sub>'''. | ||
==Properties== | ==Properties== | ||
Line 6: | Line 120: | ||
===Physical=== | ===Physical=== | ||
− | Xylitol is a white crystalline solid, with a sweet taste similar to that of sugar, though it has a slight fruity flavor. It is soluble in water (200 g/100 ml at 25 °C)<ref>[https://books.google.ro/books?id=GYauJOMebo4C&pg=PA32&lpg=PA32&dq=xylitol+water+solubility+20+degrees&source=bl&ots=W0biJJBGrQ&sig=xMLMRlSftflGrl-agenu_c8Q84g&hl=en&sa=X&ved=0CDUQ6AEwBTgUahUKEwi5wMjix7jIAhWFOxQKHdKwD8k#v=onepage&q=xylitol%20water%20solubility%2020%20degrees&f=false Bakery Products: Science and Technology, Y. H. Hui, 2006, pag. 32]</ref>, methanol (6 g/ | + | Xylitol is a white crystalline solid, with a sweet taste similar to that of sugar, though it has a slight fruity flavor. It is soluble in water (200 g/100 ml at 25 °C)<ref>[https://books.google.ro/books?id=GYauJOMebo4C&pg=PA32&lpg=PA32&dq=xylitol+water+solubility+20+degrees&source=bl&ots=W0biJJBGrQ&sig=xMLMRlSftflGrl-agenu_c8Q84g&hl=en&sa=X&ved=0CDUQ6AEwBTgUahUKEwi5wMjix7jIAhWFOxQKHdKwD8k#v=onepage&q=xylitol%20water%20solubility%2020%20degrees&f=false Bakery Products: Science and Technology, Y. H. Hui, 2006, pag. 32]</ref>, [[methanol]] (6 g/100 ml), [[ethanol]] (1.2 g/100 ml) and [[pyridine]]. It is insoluble in ether.<ref>http://www.scbt.com/datasheet-280193-xylitol.html</ref> Its melting point is between 92 to 96 °C, and the boiling point has been determined to be 345.39 °C. Xylitol has a density of 1.52 g/cm<sup>3</sup>. |
==Availability== | ==Availability== | ||
Line 13: | Line 127: | ||
==Preparation== | ==Preparation== | ||
Xylitol can be extracted from various fruits, though this process is intensive and is much cheaper to just buy it from stores. | Xylitol can be extracted from various fruits, though this process is intensive and is much cheaper to just buy it from stores. | ||
+ | |||
+ | It can also be prepared through the hydrolysis of xylan, a polysaccharide found in wood. This gives xylose, which can be reduced to xylitol. | ||
==Projects== | ==Projects== | ||
Line 21: | Line 137: | ||
===Safety=== | ===Safety=== | ||
Xylitol has no known toxicity or carcinogenicity, and is considered safe by the FDA. It has an extremely low glycemic index of 7 (glucose GI is 100) and has been shown to be useful in reducing tooth cavities. Xylitol does however have laxative effects, though it's possible to build up resistance after several weeks of consuming it. | Xylitol has no known toxicity or carcinogenicity, and is considered safe by the FDA. It has an extremely low glycemic index of 7 (glucose GI is 100) and has been shown to be useful in reducing tooth cavities. Xylitol does however have laxative effects, though it's possible to build up resistance after several weeks of consuming it. | ||
+ | |||
+ | Xylitol however may be fatal to dogs and birds. | ||
===Storage=== | ===Storage=== | ||
Line 31: | Line 149: | ||
<references/> | <references/> | ||
===Relevant Sciencemadness threads=== | ===Relevant Sciencemadness threads=== | ||
+ | *[http://www.sciencemadness.org/talk/viewthread.php?tid=8359 xylitol manufacture techniques] | ||
[[Category:Chemical compounds]] | [[Category:Chemical compounds]] |
Latest revision as of 17:51, 3 December 2021
Store-grade xylitol
| |
Names | |
---|---|
IUPAC name
(2R,4S)-Pentane-1,2,3,4,5-pentol
| |
Other names
1,2,3,4,5-Pentahydroxypentane
Xylite | |
Identifiers | |
Jmol-3D images | Image |
| |
Properties | |
C5H12O5 | |
Molar mass | 152.15 g/mol |
Appearance | White crystalline solid |
Density | 1.52 g/cm3 |
Melting point | 92–96 °C (198–205 °F; 365–369 K) |
Boiling point | 345.39 °C (653.70 °F; 618.54 K) |
200 g/100 ml (25 °C) | |
Solubility | Soluble in ethanol, methanol, pyridine, tetrahydrofuran Insoluble in diethyl ether, benzene, chloroform |
Solubility in ethanol | 1.2 g/100ml |
Solubility in methanol | 6 g/100ml |
Vapor pressure | ~0 mmHg |
Thermochemistry | |
Std enthalpy of
formation (ΔfH |
1,100.99 kJ/mol[1] |
Hazards | |
Safety data sheet | Fischer Scientific |
Related compounds | |
Related compounds
|
Arabitol Ribitol |
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa). | |
Infobox references | |
Xylitol is a sugar alcohol used as a sweetener. It has the chemical formula C5H12O5.
Contents
Properties
Chemical
Xylitol will react with nitric acid to yield xylitol nitrates.
Physical
Xylitol is a white crystalline solid, with a sweet taste similar to that of sugar, though it has a slight fruity flavor. It is soluble in water (200 g/100 ml at 25 °C)[2], methanol (6 g/100 ml), ethanol (1.2 g/100 ml) and pyridine. It is insoluble in ether.[3] Its melting point is between 92 to 96 °C, and the boiling point has been determined to be 345.39 °C. Xylitol has a density of 1.52 g/cm3.
Availability
Xylitol is available in most hypermarkets and health food stores, usually as 99-99.9% pure. The price depends on the brand.
Preparation
Xylitol can be extracted from various fruits, though this process is intensive and is much cheaper to just buy it from stores.
It can also be prepared through the hydrolysis of xylan, a polysaccharide found in wood. This gives xylose, which can be reduced to xylitol.
Projects
- Sugar substitute
- Make xylitol pentanitrate
Handling
Safety
Xylitol has no known toxicity or carcinogenicity, and is considered safe by the FDA. It has an extremely low glycemic index of 7 (glucose GI is 100) and has been shown to be useful in reducing tooth cavities. Xylitol does however have laxative effects, though it's possible to build up resistance after several weeks of consuming it.
Xylitol however may be fatal to dogs and birds.
Storage
In closed containers.
Disposal
Xylitol does not pose any danger to the environment and can be poured down the drain or dumped in the soil or trash.
References
- ↑ Tewari, Yadu B.; Goldberg, Robert N.; Journal of Chemical Thermodynamics; vol. 28; nb. 10; (1996); p. 1127 - 1144
- ↑ Bakery Products: Science and Technology, Y. H. Hui, 2006, pag. 32
- ↑ http://www.scbt.com/datasheet-280193-xylitol.html
Relevant Sciencemadness threads
- Chemical pages without CAS Registry Number
- Articles without EBI source
- Chemical pages without ChemSpiderID
- Chemical pages without DrugBank identifier
- Articles without KEGG source
- Articles without InChI source
- Articles without UNII source
- Articles containing unverified chemical infoboxes
- Chemical compounds
- Organic compounds
- Biologically-derived compounds
- Alcohols
- Polyols
- Sugar alcohols
- Readily available chemicals
- Materials available as food grade
- Edible chemicals