![[ICO]](/icons/blank.gif) | Name | Last modified | Size | Description |
|
![[PARENTDIR]](/icons/back.gif) | Parent Directory | | - | |
![[ ]](/icons/layout.gif) | Über die Amide der Kohlensäure.pdf | 2010-01-14 08:06 | 1.3M | |
![[ ]](/icons/layout.gif) | 0036-021X_43_9_R08.pdf | 2010-01-14 11:32 | 1.1M | |
![[ ]](/icons/layout.gif) | 0036-021X_45_11_R05.pdf | 2010-01-14 08:54 | 1.9M | |
![[ ]](/icons/layout.gif) | 1.pdf | 2010-01-14 08:28 | 1.1M | |
![[ ]](/icons/unknown.gif) | 1.rar | 2010-01-14 09:06 | 1.2M | |
![[ ]](/icons/layout.gif) | 2-Aminooxazoles and their derivatives (review) .pdf | 2010-01-14 09:47 | 1.0M | |
![[ ]](/icons/unknown.gif) | 3-7.rar | 2010-01-14 11:38 | 1.2M | |
![[ ]](/icons/layout.gif) | 4.pdf | 2010-01-14 09:27 | 1.8M | |
![[ ]](/icons/layout.gif) | 6-Substituted 1,3,4,5-tetrahydrobenz[cd]indol-4-amines- potent serotonin agonists .pdf | 2010-01-14 07:50 | 2.2M | |
![[ ]](/icons/unknown.gif) | 18.rar | 2010-01-14 08:31 | 1.4M | |
![[ ]](/icons/layout.gif) | 66_2339.pdf | 2010-01-14 08:00 | 1.5M | |
![[ ]](/icons/compressed.gif) | 86, 85.zip | 2010-01-14 07:53 | 1.3M | |
![[ ]](/icons/unknown.gif) | 111.rar | 2010-01-14 08:39 | 2.0M | |
![[ ]](/icons/unknown.gif) | 594(2).rar | 2010-01-14 09:07 | 1.3M | |
![[ ]](/icons/layout.gif) | 1575752.pdf | 2010-01-14 09:26 | 2.3M | |
![[ ]](/icons/layout.gif) | 14789450.5.5.pdf | 2010-01-14 10:26 | 2.7M | |
![[ ]](/icons/unknown.gif) | 46736576.rar | 2010-01-14 08:37 | 1.8M | |
![[ ]](/icons/unknown.gif) | 637563756.rar | 2010-01-14 09:55 | 1.5M | |
![[ ]](/icons/layout.gif) | 790686282.pdf | 2010-01-14 10:59 | 2.2M | |
![[ ]](/icons/unknown.gif) | 3534534654.rar | 2010-01-14 09:16 | 2.2M | |
![[ ]](/icons/layout.gif) | AMC.pdf | 2010-01-14 10:57 | 1.2M | |
![[ ]](/icons/layout.gif) | AN32 High Efficiency Linear Regulators.pdf | 2010-01-14 08:40 | 1.3M | |
![[ ]](/icons/unknown.gif) | ANHYDROUS ZIRCONIUM TETRABROMIDE.PDF | 2010-01-14 08:25 | 1.1M | |
![[ ]](/icons/layout.gif) | A New Type of Electrohydrodynamic Instability in Nematic Liquid Crystals.pdf | 2010-01-14 09:50 | 1.4M | |
![[ ]](/icons/compressed.gif) | APL1990.zip | 2010-01-14 08:01 | 1.2M | |
![[ ]](/icons/layout.gif) | A STUDY OF THE POSSIBLE ASYMMETRY OF THE ALIPHATIC DIAZO COMPOUNDS.pdf | 2010-01-14 10:22 | 1.6M | |
![[ ]](/icons/layout.gif) | Acid-catalyzed oxygen-transfer reactions of ortho-alkenyldimethylbenzylamine oxides .pdf | 2010-01-14 07:55 | 1.0M | |
![[ ]](/icons/layout.gif) | All Conjugated Block Copolymers.pdf | 2010-01-14 08:26 | 1.5M | |
![[ ]](/icons/compressed.gif) | An2007.zip | 2010-01-14 10:37 | 1.1M | |
![[ ]](/icons/compressed.gif) | AnalChem1952.zip | 2010-01-14 07:56 | 1.9M | |
![[ ]](/icons/layout.gif) | AnnalenGatt.pdf | 2010-01-14 08:30 | 1.1M | |
![[ ]](/icons/layout.gif) | Application.pdf | 2010-01-14 08:24 | 1.2M | |
![[ ]](/icons/layout.gif) | Aromatische Spirane, 20. Mitt. Darstellung von dimethylsubstituierten 2-Carboxymethyl-indan-1-onen und Benzylchloriden.pdf | 2010-01-14 08:14 | 1.0M | |
![[ ]](/icons/layout.gif) | Baudrimont_p8.pdf | 2010-01-14 09:45 | 1.1M | |
![[ ]](/icons/layout.gif) | Behavioral and Neuropharmacological Actions of N-Aralkylhydroxylamines and Their O-Methyl Ethers .pdf | 2010-01-14 09:57 | 1.2M | |
![[ ]](/icons/layout.gif) | Beiträge Zur Kenntnis des Guanazols.pdf | 2010-01-14 10:06 | 1.5M | |
![[ ]](/icons/unknown.gif) | BioPharm&BioPsych.rar | 2010-01-14 07:44 | 1.1M | |
![[ ]](/icons/layout.gif) | Brominations with N-Bromosuccinimide and Related Compounds. The Wohl-Ziegler Reaction..pdf | 2010-01-14 10:34 | 2.2M | |
![[ ]](/icons/layout.gif) | CHEMISTRY OF PYRIDO[e]COUMARINS (REVIEW) .pdf | 2010-01-14 08:56 | 1.2M | |
![[ ]](/icons/layout.gif) | Catalytic Transfer Hydrogenation.pdf | 2010-01-14 11:16 | 1.5M | |
![[ ]](/icons/layout.gif) | Chemical aspects of affinity chromatography.pdf | 2010-01-14 09:21 | 1.3M | |
![[ ]](/icons/layout.gif) | Chirale Alkoxytitan(IV)-Komplexe für enantioselektive nucleophile Additionen.pdf | 2010-01-14 10:23 | 1.4M | |
![[ ]](/icons/layout.gif) | Clandestine drug synthesis.pdf | 2010-01-14 07:43 | 2.1M | |
![[ ]](/icons/layout.gif) | Cross-metathesis of dimethyl maleate and ethylene catalyzed by second generation ruthenium carbene complexes- B3LYP.pdf | 2010-01-14 10:11 | 1.1M | |
![[ ]](/icons/layout.gif) | Cyclometalation Reactions.pdf | 2010-01-14 11:24 | 1.2M | |
![[ ]](/icons/layout.gif) | DC-Plasma Polymerization of Pyrrole .pdf | 2010-01-14 10:28 | 1.6M | |
![[ ]](/icons/layout.gif) | DC Plasma-Polymerization of Pyrrole- Comparison of Films Formed on Anode and Cathode.pdf | 2010-01-14 08:57 | 1.3M | |
![[ ]](/icons/layout.gif) | DT9890001161.pdf | 2010-01-14 09:08 | 1.3M | |
![[ ]](/icons/layout.gif) | Danilov Berich study on hydrotropic aldehyde rearrangement.pdf | 2010-01-14 10:50 | 1.4M | |
![[ ]](/icons/layout.gif) | Direct Analysis of Lipids on Thin Layer Plates by Matrix-Assisted Secondary Ion Mass Spectrometry..pdf | 2010-01-14 09:37 | 1.2M | |
![[ ]](/icons/layout.gif) | Doping and anion-exchange thermochemistry of electrochemically prepared polypyrrole.pdf | 2010-01-14 11:29 | 2.1M | |
![[ ]](/icons/compressed.gif) | Electrophoresisarticles1.zip | 2010-01-14 08:27 | 2.6M | |
![[ ]](/icons/compressed.gif) | Electrophoresisarticles2.zip | 2010-01-14 09:00 | 2.6M | |
![[ ]](/icons/layout.gif) | Evolution of the 4-anilidopiperidine class of opioid analgesics.pdf | 2010-01-14 10:18 | 1.8M | |
![[ ]](/icons/layout.gif) | FTIR and UV-Vis (diffuse reflectance) spectroscopic characterization of TiO2 sol-gel.pdf | 2010-01-14 11:40 | 1.1M | |
![[ ]](/icons/layout.gif) | For_Nicodem_03.pdf | 2010-01-14 09:44 | 1.0M | |
![[ ]](/icons/layout.gif) | Forensic Science International, 22 (1983) 265-278.pdf | 2010-01-14 09:58 | 1.6M | |
![[ ]](/icons/layout.gif) | Forensic applications of mass spectrometry.pdf | 2010-01-14 10:14 | 1.8M | |
![[ ]](/icons/layout.gif) | Frequency-resolved faradaic processes in polypyrrole films.pdf | 2010-01-14 09:16 | 1.2M | |
![[ ]](/icons/layout.gif) | GC_Russia_en.pdf | 2010-01-14 10:09 | 1.7M | |
![[ ]](/icons/layout.gif) | Heterocyclic Carbenes-A High-Yielding Synthesis of Novel, Functionalized N-Heterocyclic Carbenes in Liquid Ammonia.pdf | 2010-01-14 11:12 | 1.2M | |
![[ ]](/icons/layout.gif) | ICA1980.pdf | 2010-01-14 10:12 | 1.0M | |
![[ ]](/icons/compressed.gif) | Inorg.Chem.zip | 2010-01-14 09:49 | 1.0M | |
![[ ]](/icons/compressed.gif) | Inorganica references.zip | 2010-01-14 10:39 | 1.8M | |
![[ ]](/icons/layout.gif) | Intramolecular carbometallation of organozinc reagents..pdf | 2010-01-14 09:38 | 1.5M | |
![[ ]](/icons/layout.gif) | Investigation of the reaction between amino acids or amino acid esters and 9-formylfluorene and its equivalents.pdf | 2010-01-14 10:55 | 1.7M | |
![[ ]](/icons/layout.gif) | J. Chem. SOC., Perkin Trans. I , 1996.pdf | 2010-01-14 10:14 | 1.1M | |
![[ ]](/icons/layout.gif) | J. Org. Chem., 20(1), 118-135 (1955)..pdf | 2010-01-14 08:44 | 1.3M | |
![[ ]](/icons/layout.gif) | JACS115-6600-6608.pdf | 2010-01-14 11:34 | 1.2M | |
![[ ]](/icons/layout.gif) | JACS1968p4096.pdf | 2010-01-14 11:37 | 1.3M | |
![[ ]](/icons/layout.gif) | JAmChemSoc1930p3292.pdf | 2010-01-14 08:22 | 2.5M | |
![[ ]](/icons/layout.gif) | JAppElectrochem1982p171.pdf | 2010-01-14 11:21 | 2.2M | |
![[ ]](/icons/layout.gif) | JApplPhys_56_263.pdf | 2010-01-14 08:02 | 1.2M | |
![[ ]](/icons/layout.gif) | JCE1968p0200.pdf | 2010-01-14 10:36 | 2.8M | |
![[ ]](/icons/layout.gif) | JCE1991p0069.pdf | 2010-01-14 08:17 | 1.1M | |
![[ ]](/icons/layout.gif) | JES000485.pdf | 2010-01-14 11:42 | 1.0M | |
![[ ]](/icons/layout.gif) | JES1974p70.pdf | 2010-01-14 08:12 | 1.0M | |
![[ ]](/icons/layout.gif) | JFranklin.pdf | 2010-01-14 11:07 | 1.2M | |
![[ ]](/icons/layout.gif) | JPS1990.pdf | 2010-01-14 10:06 | 1.0M | |
![[ ]](/icons/layout.gif) | JSC.pdf | 2010-01-14 08:29 | 1.3M | |
![[ ]](/icons/layout.gif) | Jacobson.pdf | 2010-01-14 11:13 | 1.0M | |
![[ ]](/icons/unknown.gif) | Japanese Journal of Applied Physics.rar | 2010-01-14 08:23 | 1.6M | |
![[ ]](/icons/layout.gif) | Japp-Klingemann.pdf | 2010-01-14 10:58 | 1.4M | |
![[ ]](/icons/layout.gif) | Kinetics and mechanism of nitration of halogenobenzenes.pdf | 2010-01-14 11:00 | 1.5M | |
![[ ]](/icons/layout.gif) | Kinetics of PdO combustion catalysis.pdf | 2010-01-14 08:16 | 1.0M | |
![[ ]](/icons/unknown.gif) | Laser2.rar | 2010-01-14 11:39 | 1.3M | |
![[ ]](/icons/compressed.gif) | MSE06.zip | 2010-01-14 08:47 | 1.6M | |
![[ ]](/icons/layout.gif) | Magnesium-mediated ortho-specific formylation and formaldoximation of phenols.pdf | 2010-01-14 07:48 | 1.3M | |
![[ ]](/icons/layout.gif) | Mason.pdf | 2010-01-14 11:06 | 1.0M | |
![[ ]](/icons/layout.gif) | Matrix-assisted laser desorption ionization (MALDI) mass spectrometry- a novel analytical tool in molecular biology.pdf | 2010-01-14 08:07 | 1.9M | |
![[ ]](/icons/layout.gif) | Mechanism.pdf | 2010-01-14 08:48 | 1.6M | |
![[ ]](/icons/layout.gif) | Mechanism of oxidative addition. Reaction of nickel(0) complexes with aromatic halides.pdf | 2010-01-14 11:19 | 1.6M | |
![[ ]](/icons/layout.gif) | Mechanisms of Carcinogenicity of Methyl Halides.pdf | 2010-01-14 10:21 | 1.4M | |
![[ ]](/icons/layout.gif) | Mesomorphic polyelectrolytes based on side-chain liquid-crystalline polymers containing end-on fixed mesogens.pdf | 2010-01-14 07:47 | 1.3M | |
![[ ]](/icons/layout.gif) | MetallTrans1974p707.pdf | 2010-01-14 11:20 | 1.3M | |
![[ ]](/icons/layout.gif) | Microorganisms as reagents for transformations of 5α-steroids.pdf | 2010-01-14 08:35 | 1.7M | |
![[ ]](/icons/layout.gif) | Models of folate coenzymes—VII Synthesis and carbon transfer reactions of N5,N10-methenyl and N5,N10-methylenetetrahydro.pdf | 2010-01-14 10:17 | 1.0M | |
![[ ]](/icons/layout.gif) | MolPharmacol1988p15.pdf | 2010-01-14 10:10 | 1.6M | |
![[ ]](/icons/layout.gif) | Molecular structure by diffraction methods.pdf | 2010-01-14 07:54 | 2.0M | |
![[ ]](/icons/layout.gif) | Molotov cocktails and similar devices used by terrorists in israel.pdf | 2010-01-14 09:54 | 2.2M | |
![[ ]](/icons/compressed.gif) | NLOpticalPolymer.zip | 2010-01-14 08:45 | 1.1M | |
![[ ]](/icons/layout.gif) | New Methods of Preparative Organic Chemistry.pdf | 2010-01-14 08:08 | 1.3M | |
![[ ]](/icons/layout.gif) | ON THE OXIDATION OF HYDRAZINE. III. .pdf | 2010-01-14 08:43 | 1.0M | |
![[ ]](/icons/layout.gif) | ON THE OXIDATION OF HYDRAZINE. IV. .pdf | 2010-01-14 10:45 | 1.1M | |
![[ ]](/icons/layout.gif) | Ober Diaeetine und andere 61yeerinabkSmmlinge .pdf | 2010-01-14 10:51 | 1.2M | |
![[ ]](/icons/layout.gif) | Organometallic Chemistry on Silicon and Germanium Surfaces.pdf | 2010-01-14 09:02 | 1.6M | |
![[ ]](/icons/layout.gif) | Oxidation of organic compounds at the nickel hydroxide electrode.pdf | 2010-01-14 11:32 | 1.6M | |
![[ ]](/icons/layout.gif) | Oxide ultra-thin films on metals- new materials for the design of supported metal catalysts.pdf | 2010-01-14 10:54 | 2.6M | |
![[ ]](/icons/layout.gif) | PAD.pdf | 2010-01-14 09:22 | 1.8M | |
![[ ]](/icons/unknown.gif) | PPS873.z01 | 2010-01-14 11:05 | 1.0M | |
![[ ]](/icons/layout.gif) | PR1937.pdf | 2010-01-14 07:45 | 1.5M | |
![[ ]](/icons/layout.gif) | PR1939.pdf | 2010-01-14 11:04 | 1.2M | |
![[ ]](/icons/layout.gif) | PT1994.pdf | 2010-01-14 10:52 | 1.9M | |
![[ ]](/icons/layout.gif) | Pages 1 to 16 from polysulphides of the alkali metals j._chem._soc._1930_1473-1497.pdf | 2010-01-14 07:51 | 1.0M | |
![[ ]](/icons/layout.gif) | Pages 17 to 27 from polysulphides of the alkali metals j._chem._soc._1930_1473-1497.pdf | 2010-01-14 10:01 | 1.0M | |
![[ ]](/icons/layout.gif) | Palladium- or nickel-catalyzed cross coupling. A new selective method for carbon-carbon bond formatio.pdf | 2010-01-14 08:53 | 1.1M | |
![[ ]](/icons/layout.gif) | Physical properties and atomic arrangements in crystals.pdf | 2010-01-14 10:00 | 1.5M | |
![[ ]](/icons/layout.gif) | Physicochemical characterization of furosemide modifications.pdf | 2010-01-14 10:19 | 1.6M | |
![[ ]](/icons/layout.gif) | Postelectrophoretic staining of proteins separated by two-dimensional gel electrophoresis using SYPRO dyes.pdf | 2010-01-14 08:34 | 2.2M | |
![[ ]](/icons/layout.gif) | Preparation, Properties, and Spectra of Eight Alkylated Indenes.pdf | 2010-01-14 11:14 | 1.4M | |
![[ ]](/icons/layout.gif) | Preparation of Some Aliphatic Azo Nitriles.pdf | 2010-01-14 08:16 | 1.5M | |
![[ ]](/icons/layout.gif) | Properties of aluminum doped ZnO.pdf | 2010-01-14 11:11 | 1.4M | |
![[ ]](/icons/unknown.gif) | R-NO2.rar | 2010-01-14 10:32 | 1.1M | |
![[ ]](/icons/layout.gif) | RCR_32_5_R03.pdf | 2010-01-14 09:31 | 1.9M | |
![[TXT]](/icons/text.gif) | Readme.txt | 2010-01-14 08:39 | 328 | |
![[ ]](/icons/layout.gif) | Recent trends in high-energy materials.pdf | 2010-01-14 10:16 | 2.9M | |
![[ ]](/icons/layout.gif) | Reflex responses to capsaicin- intravenous, aerosol, and intratracheal administration.pdf | 2010-01-14 09:47 | 2.3M | |
![[ ]](/icons/layout.gif) | Russian Chemical Reviews, 46 (5), 1977.pdf | 2010-01-14 09:42 | 1.7M | |
![[ ]](/icons/compressed.gif) | SM1996.zip | 2010-01-14 09:05 | 1.0M | |
![[ ]](/icons/compressed.gif) | Sauron.zip | 2010-01-14 11:23 | 1.3M | |
![[ ]](/icons/layout.gif) | Sauron Ber 1868.pdf | 2010-01-14 10:56 | 1.4M | |
![[ ]](/icons/layout.gif) | Scope and Limitations in the Use of -Silyl and -Stannyl Sulfones as Latent -Sulfonyl Anions.pdf | 2010-01-14 09:22 | 1.0M | |
![[ ]](/icons/layout.gif) | Six-wave mixing probe of light-induced second-harmonic generation- example of dye solutions .pdf | 2010-01-14 09:03 | 1.4M | |
![[ ]](/icons/layout.gif) | Snake venom variability'methods of study, results and interpretation.pdf | 2010-01-14 09:52 | 1.8M | |
![[ ]](/icons/layout.gif) | Sol-gel film-preparation of novel electrodes for the electrocatalytic oxidation of organic pollutants in water .pdf | 2010-01-14 08:04 | 1.3M | |
![[ ]](/icons/unknown.gif) | Spinger&SD.rar | 2010-01-14 11:13 | 1.2M | |
![[ ]](/icons/unknown.gif) | Spontaneous Heating and Pyrophoricity .rtf | 2010-01-14 10:42 | 2.7M | |
![[ ]](/icons/layout.gif) | Staining and quantification of proteins separated by polyacrylamide gel electrophoresis. .pdf | 2010-01-14 10:44 | 1.7M | |
![[ ]](/icons/layout.gif) | State-of-the-art two-dimensional gel electrophoresis- a key tool of proteomics research .pdf | 2010-01-14 11:33 | 1.7M | |
![[ ]](/icons/layout.gif) | Sterols. CLVII. Sapogenins. LXIX.1 Isolation and Structures of Thirteen New Steroidal Sapogenins.pdf | 2010-01-14 10:49 | 1.9M | |
![[ ]](/icons/layout.gif) | Structural Characterization, Solution Studies, and DFT Calculations on a Series of Binuclear Gold(III) Oxo Complexes.pdf | 2010-01-14 08:50 | 1.2M | |
![[ ]](/icons/layout.gif) | Structures of Tin Oxide-Antimony Oxide Catalysts.pdf | 2010-01-14 10:38 | 1.1M | |
![[ ]](/icons/layout.gif) | Studies in the azole series. Part II. The interaction of -amino-nitriles and carbon disulphide.pdf | 2010-01-14 08:52 | 1.4M | |
![[ ]](/icons/layout.gif) | Studies in the indole series. Part I. Indolylalkylamines.pdf | 2010-01-14 11:22 | 1.4M | |
![[ ]](/icons/layout.gif) | Synthesen von Benzolhydrazinen mittelst Hydrazinhydrat.pdf | 2010-01-14 09:01 | 1.5M | |
![[ ]](/icons/layout.gif) | Syntheses of alkyl (E)-(1-aryl-2-pyrrolidinylidene)acetates.pdf | 2010-01-14 09:28 | 1.1M | |
![[ ]](/icons/layout.gif) | Synthesis of Arginine.pdf | 2010-01-14 11:24 | 1.1M | |
![[ ]](/icons/layout.gif) | Synthesis of aldehydes from dihydro-1,3-oxazines.pdf | 2010-01-14 11:30 | 2.6M | |
![[ ]](/icons/layout.gif) | Synthesis of alumina nanofibers by a mercury-mediated method.pdf | 2010-01-14 10:20 | 1.3M | |
![[ ]](/icons/layout.gif) | Synthesis of nitrogen-containing heterocyclic compounds based onα-haloketones (review).pdf | 2010-01-14 08:20 | 1.1M | |
![[ ]](/icons/layout.gif) | TADDOls - from Enantioselective Catalysis to Dendritic Cross linkersCrystals .pdf | 2010-01-14 08:10 | 2.7M | |
![[ ]](/icons/layout.gif) | TDA2006 Audio Amp under 0.2V input threshold.pdf | 2010-01-14 11:06 | 1.5M | |
![[ ]](/icons/layout.gif) | THE HEXAPHENYLETHANE RIDDLE .pdf | 2010-01-14 09:32 | 1.4M | |
![[ ]](/icons/layout.gif) | Tetrahedron report number 163 -Copper assisted nucleophilic substitution of aryl halogen .pdf | 2010-01-14 09:09 | 2.0M | |
![[ ]](/icons/layout.gif) | The Effect of tetramethylethylenediamine on the metalation of o- and p-N,N-dimethyltoluidines with n-butyllithium.pdf | 2010-01-14 08:13 | 1.2M | |
![[ ]](/icons/layout.gif) | The Gas-phase Nitration of Alkanes.pdf | 2010-01-14 10:05 | 1.8M | |
![[ ]](/icons/layout.gif) | The Origins of Laurents Organic Classification.pdf | 2010-01-14 09:04 | 1.5M | |
![[ ]](/icons/layout.gif) | The Preparation and Bacteriostatic Activity of Substituted Ureas.pdf | 2010-01-14 10:24 | 1.1M | |
![[ ]](/icons/layout.gif) | The adsorption of large proteins in electrofocusing on immobilized pH gradients- II.pdf | 2010-01-14 07:58 | 1.9M | |
![[ ]](/icons/layout.gif) | The development of a cobalt oxide spinel structure overlayer on cobalt electrodes -A modified electrode surface.pdf | 2010-01-14 08:51 | 1.0M | |
![[ ]](/icons/layout.gif) | The electrodeposition of lead dioxide on titanium.pdf | 2010-01-14 10:27 | 1.3M | |
![[ ]](/icons/layout.gif) | The fabrication of lead dioxide layers on a titanium substrate .pdf | 2010-01-14 10:43 | 1.7M | |
![[ ]](/icons/layout.gif) | The fabrication of lead dioxide layers on a titanium substrate.pdf | 2010-01-14 09:18 | 1.7M | |
![[ ]](/icons/layout.gif) | The use of oxalyl chloride and bromice for producing acid chlorides, acid bromides or acid anhydrides III.pdf | 2010-01-14 09:32 | 1.1M | |
![[ ]](/icons/layout.gif) | Time-of-flight mass spectrometry.pdf | 2010-01-14 11:02 | 1.8M | |
![[ ]](/icons/layout.gif) | Titration of antibodies.pdf | 2010-01-14 09:11 | 1.1M | |
![[ ]](/icons/compressed.gif) | TrAC1989.zip | 2010-01-14 11:35 | 1.6M | |
![[ ]](/icons/layout.gif) | Tricine-sodium dodecyl sulfate polyacrylamide gel electrophoresis for the separation of proteins.pdf | 2010-01-14 08:19 | 1.4M | |
![[ ]](/icons/layout.gif) | US2006219 Ammonium Sulfide Production.pdf | 2010-01-14 09:32 | 183K | |
![[ ]](/icons/layout.gif) | US2796325 NaOH or Ca(OH)2 + Sulfur Polysulfide and Sulfite Manufacture.pdf | 2010-01-14 08:23 | 276K | |
![[ ]](/icons/layout.gif) | US6533943 Ca metasulfides from Ca(OH)2 + molten Sulfur.pdf | 2010-01-14 08:19 | 404K | |
![[ ]](/icons/unknown.gif) | Uber Nitro And Amidoguanidin.PDF | 2010-01-14 11:10 | 2.5M | |
![[TXT]](/icons/text.gif) | Ueber ,activirte-Metalle (Metallpaare) und die Verwendnng des activirten Alumiuinms zur Reduction in neutra.ler L6sung.p | 2010-01-14 10:08 | 2.4M | |
![[ ]](/icons/layout.gif) | Ueber Biuret und Biuretreaction.pdf | 2010-01-14 07:57 | 1.2M | |
![[ ]](/icons/layout.gif) | Untersuchungen in der Phenylalanin-Reihe VI.pdf | 2010-01-14 11:41 | 1.1M | |
![[ ]](/icons/layout.gif) | Water-Soluble Ligands, Metal Complexes, and Catalysts-Synergism of Homogeneous and Heterogeneous Catalysis.pdf | 2010-01-14 10:30 | 2.7M | |
![[ ]](/icons/layout.gif) | Zinkchloridkatalysierte, thermische Umlagerungen von N-Allyl in C-Allyl-aniline- ladungsinduzierte, aromatische Amino-Cl.pdf | 2010-01-14 11:27 | 1.3M | |
![[ ]](/icons/layout.gif) | Zur Begrundung der Oxoniumtheorie.pdf | 2010-01-14 10:01 | 1.7M | |
![[ ]](/icons/layout.gif) | acylboro.pdf | 2010-01-14 11:18 | 1.8M | |
![[ ]](/icons/layout.gif) | arsulfone.pdf | 2010-01-14 07:48 | 1.0M | |
![[ ]](/icons/unknown.gif) | attachment.rar | 2010-01-14 08:05 | 1.8M | |
![[ ]](/icons/compressed.gif) | azide thread references .zip | 2010-01-14 09:39 | 1.4M | |
![[ ]](/icons/layout.gif) | benzyloxy.pdf | 2010-01-14 10:12 | 1.2M | |
![[ ]](/icons/compressed.gif) | biochem&biophys.zip | 2010-01-14 10:48 | 1.2M | |
![[ ]](/icons/layout.gif) | bmm.pdf | 2010-01-14 09:25 | 1.2M | |
![[ ]](/icons/layout.gif) | booktext(2).pdf | 2010-01-14 09:34 | 1.6M | |
![[ ]](/icons/unknown.gif) | chemistry.tar.gz.torrent | 2010-01-14 08:39 | 25K | |
![[ ]](/icons/layout.gif) | cr60324a002.pdf | 2010-01-14 10:46 | 1.4M | |
![[ ]](/icons/layout.gif) | diniclbenz.pdf | 2010-01-14 08:38 | 1.2M | |
![[ ]](/icons/layout.gif) | epoxreact.pdf | 2010-01-14 09:36 | 2.4M | |
![[ ]](/icons/unknown.gif) | for Rosco Bodine .rar | 2010-01-14 08:12 | 2.6M | |
![[ ]](/icons/layout.gif) | for jokull.pdf | 2010-01-14 09:17 | 1.4M | |
![[ ]](/icons/layout.gif) | for myinformation.pdf | 2010-01-14 11:41 | 1.2M | |
![[ ]](/icons/layout.gif) | for quino 4.pdf | 2010-01-14 11:43 | 1.7M | |
![[ ]](/icons/layout.gif) | for sauran.pdf | 2010-01-14 08:41 | 1.9M | |
![[ ]](/icons/layout.gif) | fulltext(2).pdf | 2010-01-14 09:33 | 1.0M | |
![[ ]](/icons/layout.gif) | fulltext(14).pdf | 2010-01-14 07:52 | 2.0M | |
![[ ]](/icons/layout.gif) | fulltext.pdf | 2010-01-14 09:57 | 2.6M | |
![[ ]](/icons/unknown.gif) | fulltext[1]11.PDF | 2010-01-14 09:44 | 1.6M | |
![[ ]](/icons/layout.gif) | homologues (I).pdf | 2010-01-14 10:40 | 1.1M | |
![[ ]](/icons/layout.gif) | homologues (II).pdf | 2010-01-14 08:34 | 1.1M | |
![[ ]](/icons/unknown.gif) | hydro.rar | 2010-01-14 09:20 | 1.9M | |
![[ ]](/icons/layout.gif) | iuber die HHnwirkung von Aldehyden auf Hydramine der Pyrrolidin- und Piperidin-Reihe. (U. Mitteilung dber eine neue Oxyd.pdf | 2010-01-14 09:10 | 1.0M | |
![[ ]](/icons/layout.gif) | j.electacta.2007.04.002.pdf | 2010-01-14 10:37 | 1.3M | |
![[ ]](/icons/layout.gif) | ja00071a029.pdf | 2010-01-14 09:48 | 1.6M | |
![[ ]](/icons/layout.gif) | ja039254l.pdf | 2010-01-14 11:03 | 2.2M | |
![[ ]](/icons/layout.gif) | jjf802487s.pdf | 2010-01-14 11:08 | 1.8M | |
![[ ]](/icons/layout.gif) | jm00046a006.pdf | 2010-01-14 07:59 | 1.1M | |
![[ ]](/icons/layout.gif) | kwart.pdf | 2010-01-14 08:57 | 1.1M | |
![[ ]](/icons/layout.gif) | ma00207a008.pdf | 2010-01-14 07:46 | 1.6M | |
![[ ]](/icons/layout.gif) | macromolecules1990.pdf | 2010-01-14 11:36 | 1.7M | |
![[ ]](/icons/unknown.gif) | matei.rar | 2010-01-14 09:43 | 1.5M | |
![[ ]](/icons/layout.gif) | matei2.pdf | 2010-01-14 09:29 | 1.8M | |
![[ ]](/icons/compressed.gif) | matei journal citations .zip | 2010-01-14 08:55 | 1.1M | |
![[ ]](/icons/compressed.gif) | mercury(II)complexes (Acta Crystallographica Section E).zip | 2010-01-14 09:37 | 1.2M | |
![[ ]](/icons/layout.gif) | microwave.organic.chemistry.review.pdf | 2010-01-14 10:03 | 1.6M | |
![[ ]](/icons/unknown.gif) | nature.rar | 2010-01-14 09:12 | 1.1M | |
![[ ]](/icons/unknown.gif) | nitrostuff4axt.rar | 2010-01-14 09:24 | 1.8M | |
![[ ]](/icons/unknown.gif) | nitrotriazolone and aliphatic diazo salts.rar | 2010-01-14 10:03 | 1.3M | |
![[ ]](/icons/layout.gif) | notes on different topics.pdf | 2010-01-14 08:58 | 1.1M | |
![[ ]](/icons/layout.gif) | pr1933.pdf | 2010-01-14 09:51 | 1.5M | |
![[ ]](/icons/compressed.gif) | proteomic.zip | 2010-01-14 10:31 | 2.7M | |
![[ ]](/icons/unknown.gif) | quino.rar | 2010-01-14 09:05 | 1.0M | |
![[ ]](/icons/compressed.gif) | quino1382008.zip | 2010-01-14 10:47 | 1.5M | |
![[IMG]](/icons/image2.gif) | r.j._sundberg._indoles._1996.djvu | 2010-01-14 11:15 | 1.7M | |
![[ ]](/icons/compressed.gif) | references for Mert.zip | 2010-01-14 08:18 | 1.4M | |
![[ ]](/icons/layout.gif) | ruthenium_rhodium_and_palladium_complexes_of_pyridines.pdf | 2010-01-14 08:03 | 1.6M | |
![[ ]](/icons/layout.gif) | s-1974-23386.pdf | 2010-01-14 09:40 | 1.4M | |
![[ ]](/icons/layout.gif) | s-1995-3934.pdf | 2010-01-14 08:51 | 1.1M | |
![[ ]](/icons/layout.gif) | sdarticle.pdf | 2010-01-14 08:42 | 1.7M | |
![[ ]](/icons/layout.gif) | shotten-bauman I.pdf | 2010-01-14 09:12 | 1.1M | |
![[ ]](/icons/unknown.gif) | sparky.rar | 2010-01-14 08:49 | 1.9M | |
![[ ]](/icons/unknown.gif) | springer.rar | 2010-01-14 08:32 | 2.0M | |
![[ ]](/icons/unknown.gif) | tetlett&JChemSoc.rar | 2010-01-14 08:46 | 1.5M | |
![[ ]](/icons/compressed.gif) | tetrahedron articles.zip | 2010-01-14 08:15 | 1.1M | |
![[ ]](/icons/layout.gif) | tetramethylethylenediamine on the migration of proteins in SDS polyacrylamide gels.pdf | 2010-01-14 11:26 | 2.8M | |
![[ ]](/icons/compressed.gif) | tomyinformation.zip | 2010-01-14 09:14 | 2.4M | |
|